C15H8Cl5FO — CID 134615598
1-[4-fluoro-2-(2,3,4,5,6-pentachlorophenyl)phenyl]propan-1-one (PubChem CID 134615598) has the molecular formula C15H8Cl5FO and a molecular weight of 400.49 g/mol. Its IUPAC name is 1-[4-fluoro-2-(2,3,4,5,6-pentachlorophenyl)phenyl]propan-1-one.
| Compound Name | 1-[4-fluoro-2-(2,3,4,5,6-pentachlorophenyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 134615598 |
| Molecular Formula | C15H8Cl5FO |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 397.90 |
| IUPAC Name | 1-[4-fluoro-2-(2,3,4,5,6-pentachlorophenyl)phenyl]propan-1-one |
| SMILES | CCC(=O)c1ccc(F)cc1-c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C15H8Cl5FO/c1-2-9(22)7-4-3-6(21)5-8(7)10-11(16)13(18)15(20)14(19)12(10)17/h3-5H,2H2,1H3 |
| InChIKey | XQXNEDNYHJHRFA-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|