C12H14ClFO — CID 146009446
1-(2-chloro-4-fluorophenyl)-3,3-dimethylbutan-1-one (PubChem CID 146009446) has the molecular formula C12H14ClFO and a molecular weight of 228.69 g/mol. Its IUPAC name is 1-(2-chloro-4-fluorophenyl)-3,3-dimethylbutan-1-one.
| Compound Name | 1-(2-chloro-4-fluorophenyl)-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 146009446 |
| Molecular Formula | C12H14ClFO |
| Molecular Weight | 228.69 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 1-(2-chloro-4-fluorophenyl)-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)CC(=O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C12H14ClFO/c1-12(2,3)7-11(15)9-5-4-8(14)6-10(9)13/h4-6H,7H2,1-3H3 |
| InChIKey | ZZKWVZILPHJHSO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.69 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |