C13H17ClO — CID 146009717
1-(2-chloro-4-methylphenyl)-3,3-dimethylbutan-1-one (PubChem CID 146009717) has the molecular formula C13H17ClO and a molecular weight of 224.73 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)-3,3-dimethylbutan-1-one.
| Compound Name | 1-(2-chloro-4-methylphenyl)-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 146009717 |
| Molecular Formula | C13H17ClO |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)-3,3-dimethylbutan-1-one |
| SMILES | Cc1ccc(C(=O)CC(C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C13H17ClO/c1-9-5-6-10(11(14)7-9)12(15)8-13(2,3)4/h5-7H,8H2,1-4H3 |
| InChIKey | KEUSEVJOCKMMEG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |