C12H15ClFNO2 — CID 113343249
2-chloro-4-fluoro-N-(4-hydroxy-2-methylbutan-2-yl)benzamide (PubChem CID 113343249) has the molecular formula C12H15ClFNO2 and a molecular weight of 259.71 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-(4-hydroxy-2-methylbutan-2-yl)benzamide.
| Compound Name | 2-chloro-4-fluoro-N-(4-hydroxy-2-methylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 113343249 |
| Molecular Formula | C12H15ClFNO2 |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2-chloro-4-fluoro-N-(4-hydroxy-2-methylbutan-2-yl)benzamide |
| SMILES | CC(C)(CCO)NC(=O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C12H15ClFNO2/c1-12(2,5-6-16)15-11(17)9-4-3-8(14)7-10(9)13/h3-4,7,16H,5-6H2,1-2H3,(H,15,17) |
| InChIKey | YJRQDDMHRNXYEB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |