C12H14BrClFNO2 — CID 119052227
2-bromo-5-chloro-3-fluoro-N-(4-hydroxy-2-methylbutan-2-yl)benzamide (PubChem CID 119052227) has the molecular formula C12H14BrClFNO2 and a molecular weight of 338.60 g/mol. Its IUPAC name is 2-bromo-5-chloro-3-fluoro-N-(4-hydroxy-2-methylbutan-2-yl)benzamide.
| Compound Name | 2-bromo-5-chloro-3-fluoro-N-(4-hydroxy-2-methylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 119052227 |
| Molecular Formula | C12H14BrClFNO2 |
| Molecular Weight | 338.60 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 2-bromo-5-chloro-3-fluoro-N-(4-hydroxy-2-methylbutan-2-yl)benzamide |
| SMILES | CC(C)(CCO)NC(=O)c1cc(Cl)cc(F)c1Br |
| InChI | InChI=1S/C12H14BrClFNO2/c1-12(2,3-4-17)16-11(18)8-5-7(14)6-9(15)10(8)13/h5-6,17H,3-4H2,1-2H3,(H,16,18) |
| InChIKey | FARYTBSTDGSUGZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.60 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|