C11H14Cl2N2O2 — CID 115969021
2,6-dichloro-N-(4-hydroxy-2-methylbutan-2-yl)pyridine-4-carboxamide (PubChem CID 115969021) has the molecular formula C11H14Cl2N2O2 and a molecular weight of 277.15 g/mol. Its IUPAC name is 2,6-dichloro-N-(4-hydroxy-2-methylbutan-2-yl)pyridine-4-carboxamide.
| Compound Name | 2,6-dichloro-N-(4-hydroxy-2-methylbutan-2-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 115969021 |
| Molecular Formula | C11H14Cl2N2O2 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 2,6-dichloro-N-(4-hydroxy-2-methylbutan-2-yl)pyridine-4-carboxamide |
| SMILES | CC(C)(CCO)NC(=O)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C11H14Cl2N2O2/c1-11(2,3-4-16)15-10(17)7-5-8(12)14-9(13)6-7/h5-6,16H,3-4H2,1-2H3,(H,15,17) |
| InChIKey | OXLGZGYQXQGMLH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|