C13H18Cl2N2O — CID 65038933
2,6-dichloro-N-(3-ethylpentan-3-yl)pyridine-4-carboxamide (PubChem CID 65038933) has the molecular formula C13H18Cl2N2O and a molecular weight of 289.21 g/mol. Its IUPAC name is 2,6-dichloro-N-(3-ethylpentan-3-yl)pyridine-4-carboxamide.
| Compound Name | 2,6-dichloro-N-(3-ethylpentan-3-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 65038933 |
| Molecular Formula | C13H18Cl2N2O |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2,6-dichloro-N-(3-ethylpentan-3-yl)pyridine-4-carboxamide |
| SMILES | CCC(CC)(CC)NC(=O)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C13H18Cl2N2O/c1-4-13(5-2,6-3)17-12(18)9-7-10(14)16-11(15)8-9/h7-8H,4-6H2,1-3H3,(H,17,18) |
| InChIKey | ZMMDKKXBSRZRTE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|