C15H22F2N2O — CID 65042721
N-(3-ethylpentan-3-yl)-3,5-difluoro-4-(methylamino)benzamide (PubChem CID 65042721) has the molecular formula C15H22F2N2O and a molecular weight of 284.35 g/mol. Its IUPAC name is N-(3-ethylpentan-3-yl)-3,5-difluoro-4-(methylamino)benzamide.
| Compound Name | N-(3-ethylpentan-3-yl)-3,5-difluoro-4-(methylamino)benzamide |
|---|---|
| PubChem CID | 65042721 |
| Molecular Formula | C15H22F2N2O |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | N-(3-ethylpentan-3-yl)-3,5-difluoro-4-(methylamino)benzamide |
| SMILES | CCC(CC)(CC)NC(=O)c1cc(F)c(NC)c(F)c1 |
| InChI | InChI=1S/C15H22F2N2O/c1-5-15(6-2,7-3)19-14(20)10-8-11(16)13(18-4)12(17)9-10/h8-9,18H,5-7H2,1-4H3,(H,19,20) |
| InChIKey | VUSQSODXRHQLOE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |