C13H17BrClNO — CID 103764879
2-bromo-4-chloro-N-(2-methylpentan-2-yl)benzamide (PubChem CID 103764879) has the molecular formula C13H17BrClNO and a molecular weight of 318.64 g/mol. Its IUPAC name is 2-bromo-4-chloro-N-(2-methylpentan-2-yl)benzamide.
| Compound Name | 2-bromo-4-chloro-N-(2-methylpentan-2-yl)benzamide |
|---|---|
| PubChem CID | 103764879 |
| Molecular Formula | C13H17BrClNO |
| Molecular Weight | 318.64 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 2-bromo-4-chloro-N-(2-methylpentan-2-yl)benzamide |
| SMILES | CCCC(C)(C)NC(=O)c1ccc(Cl)cc1Br |
| InChI | InChI=1S/C13H17BrClNO/c1-4-7-13(2,3)16-12(17)10-6-5-9(15)8-11(10)14/h5-6,8H,4,7H2,1-3H3,(H,16,17) |
| InChIKey | LIEFUZSFAVYNLF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.64 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |