C11H11BrCl3NO — CID 107994107
2-bromo-4-chloro-N-(1,3-dichloro-2-methylpropan-2-yl)benzamide (PubChem CID 107994107) has the molecular formula C11H11BrCl3NO and a molecular weight of 359.48 g/mol. Its IUPAC name is 2-bromo-4-chloro-N-(1,3-dichloro-2-methylpropan-2-yl)benzamide.
| Compound Name | 2-bromo-4-chloro-N-(1,3-dichloro-2-methylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 107994107 |
| Molecular Formula | C11H11BrCl3NO |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 356.91 |
| IUPAC Name | 2-bromo-4-chloro-N-(1,3-dichloro-2-methylpropan-2-yl)benzamide |
| SMILES | CC(CCl)(CCl)NC(=O)c1ccc(Cl)cc1Br |
| InChI | InChI=1S/C11H11BrCl3NO/c1-11(5-13,6-14)16-10(17)8-3-2-7(15)4-9(8)12/h2-4H,5-6H2,1H3,(H,16,17) |
| InChIKey | UGSYDUGPPASWHD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|