C14H17BrClNO3 — CID 107986918
2-[[(2-bromo-4-chlorobenzoyl)amino]methyl]-2-ethylbutanoic acid (PubChem CID 107986918) has the molecular formula C14H17BrClNO3 and a molecular weight of 362.65 g/mol. Its IUPAC name is 2-[[(2-bromo-4-chlorobenzoyl)amino]methyl]-2-ethylbutanoic acid.
| Compound Name | 2-[[(2-bromo-4-chlorobenzoyl)amino]methyl]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 107986918 |
| Molecular Formula | C14H17BrClNO3 |
| Molecular Weight | 362.65 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 2-[[(2-bromo-4-chlorobenzoyl)amino]methyl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(CNC(=O)c1ccc(Cl)cc1Br)C(=O)O |
| InChI | InChI=1S/C14H17BrClNO3/c1-3-14(4-2,13(19)20)8-17-12(18)10-6-5-9(16)7-11(10)15/h5-7H,3-4,8H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | NMDMMMQTHVRFRC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.65 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |