C11H16ClNO2 — CID 106687245
2-chloro-N-(2-methylpentan-2-yl)furan-3-carboxamide (PubChem CID 106687245) has the molecular formula C11H16ClNO2 and a molecular weight of 229.71 g/mol. Its IUPAC name is 2-chloro-N-(2-methylpentan-2-yl)furan-3-carboxamide.
| Compound Name | 2-chloro-N-(2-methylpentan-2-yl)furan-3-carboxamide |
|---|---|
| PubChem CID | 106687245 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-chloro-N-(2-methylpentan-2-yl)furan-3-carboxamide |
| SMILES | CCCC(C)(C)NC(=O)c1ccoc1Cl |
| InChI | InChI=1S/C11H16ClNO2/c1-4-6-11(2,3)13-10(14)8-5-7-15-9(8)12/h5,7H,4,6H2,1-3H3,(H,13,14) |
| InChIKey | CCCFKXNVHSCIAH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |