C9H11ClN2O3 — CID 106686516
N-(1-amino-2-methyl-1-oxopropan-2-yl)-2-chlorofuran-3-carboxamide (PubChem CID 106686516) has the molecular formula C9H11ClN2O3 and a molecular weight of 230.65 g/mol. Its IUPAC name is N-(1-amino-2-methyl-1-oxopropan-2-yl)-2-chlorofuran-3-carboxamide.
| Compound Name | N-(1-amino-2-methyl-1-oxopropan-2-yl)-2-chlorofuran-3-carboxamide |
|---|---|
| PubChem CID | 106686516 |
| Molecular Formula | C9H11ClN2O3 |
| Molecular Weight | 230.65 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | N-(1-amino-2-methyl-1-oxopropan-2-yl)-2-chlorofuran-3-carboxamide |
| SMILES | CC(C)(NC(=O)c1ccoc1Cl)C(N)=O |
| InChI | InChI=1S/C9H11ClN2O3/c1-9(2,8(11)14)12-7(13)5-3-4-15-6(5)10/h3-4H,1-2H3,(H2,11,14)(H,12,13) |
| InChIKey | CPVHHTXALRJGKF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.65 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |