C10H14ClNO3 — CID 106687227
2-chloro-N-(2-methoxy-2-methylpropyl)furan-3-carboxamide (PubChem CID 106687227) has the molecular formula C10H14ClNO3 and a molecular weight of 231.68 g/mol. Its IUPAC name is 2-chloro-N-(2-methoxy-2-methylpropyl)furan-3-carboxamide.
| Compound Name | 2-chloro-N-(2-methoxy-2-methylpropyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 106687227 |
| Molecular Formula | C10H14ClNO3 |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 2-chloro-N-(2-methoxy-2-methylpropyl)furan-3-carboxamide |
| SMILES | COC(C)(C)CNC(=O)c1ccoc1Cl |
| InChI | InChI=1S/C10H14ClNO3/c1-10(2,14-3)6-12-9(13)7-4-5-15-8(7)11/h4-5H,6H2,1-3H3,(H,12,13) |
| InChIKey | SDEZDGZYTWARTA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |