C10H10Cl2NO4S- — CID 174435055
(2,6-dichloro-N-methyl-3-propanoylanilino) sulfite (PubChem CID 174435055) has the molecular formula C10H10Cl2NO4S- and a molecular weight of 311.17 g/mol. Its IUPAC name is (2,6-dichloro-N-methyl-3-propanoylanilino) sulfite.
| Compound Name | (2,6-dichloro-N-methyl-3-propanoylanilino) sulfite |
|---|---|
| PubChem CID | 174435055 |
| Molecular Formula | C10H10Cl2NO4S- |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 309.97 |
| IUPAC Name | (2,6-dichloro-N-methyl-3-propanoylanilino) sulfite |
| SMILES | CCC(=O)c1ccc(Cl)c(N(C)OS(=O)[O-])c1Cl |
| InChI | InChI=1S/C10H11Cl2NO4S/c1-3-8(14)6-4-5-7(11)10(9(6)12)13(2)17-18(15)16/h4-5H,3H2,1-2H3,(H,15,16)/p-1 |
| InChIKey | SUJKILDVPYUJRM-UHFFFAOYSA-M |
| XLogP | 2.75 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|