C24H23F2N3O4S — CID 146261828
3-amino-4-[(2,2-difluoro-1,3-benzodioxol-4-yl)methylamino]-N-[(4-ethylsulfinylphenyl)methyl]benzamide (PubChem CID 146261828) has the molecular formula C24H23F2N3O4S and a molecular weight of 487.53 g/mol. Its IUPAC name is 3-amino-4-[(2,2-difluoro-1,3-benzodioxol-4-yl)methylamino]-N-[(4-ethylsulfinylphenyl)methyl]benzamide.
| Compound Name | 3-amino-4-[(2,2-difluoro-1,3-benzodioxol-4-yl)methylamino]-N-[(4-ethylsulfinylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 146261828 |
| Molecular Formula | C24H23F2N3O4S |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 3-amino-4-[(2,2-difluoro-1,3-benzodioxol-4-yl)methylamino]-N-[(4-ethylsulfinylphenyl)methyl]benzamide |
| SMILES | CCS(=O)c1ccc(CNC(=O)c2ccc(NCc3cccc4c3OC(F)(F)O4)c(N)c2)cc1 |
| InChI | InChI=1S/C24H23F2N3O4S/c1-2-34(31)18-9-6-15(7-10-18)13-29-23(30)16-8-11-20(19(27)12-16)28-14-17-4-3-5-21-22(17)33-24(25,26)32-21/h3-12,28H,2,13-14,27H2,1H3,(H,29,30) |
| InChIKey | GNHJFTTYGLEDAR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|