C17H17FN2O4 — CID 166689544
methyl 3-amino-4-[[(2S)-2-fluoro-2-methyl-1,3-benzodioxol-4-yl]methylamino]benzoate (PubChem CID 166689544) has the molecular formula C17H17FN2O4 and a molecular weight of 332.33 g/mol. Its IUPAC name is methyl 3-amino-4-[[(2S)-2-fluoro-2-methyl-1,3-benzodioxol-4-yl]methylamino]benzoate.
| Compound Name | methyl 3-amino-4-[[(2S)-2-fluoro-2-methyl-1,3-benzodioxol-4-yl]methylamino]benzoate |
|---|---|
| PubChem CID | 166689544 |
| Molecular Formula | C17H17FN2O4 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | methyl 3-amino-4-[[(2S)-2-fluoro-2-methyl-1,3-benzodioxol-4-yl]methylamino]benzoate |
| SMILES | COC(=O)c1ccc(NCc2cccc3c2O[C@@](C)(F)O3)c(N)c1 |
| InChI | InChI=1S/C17H17FN2O4/c1-17(18)23-14-5-3-4-11(15(14)24-17)9-20-13-7-6-10(8-12(13)19)16(21)22-2/h3-8,20H,9,19H2,1-2H3/t17-/m0/s1 |
| InChIKey | TVMUHNAUCIQHNI-KRWDZBQOSA-N |
| XLogP | 3.08 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|