C15H14BrN3S2 — CID 172852922
4-bromo-1-N-[(2-methylsulfanyl-1,3-benzothiazol-4-yl)methyl]benzene-1,2-diamine (PubChem CID 172852922) has the molecular formula C15H14BrN3S2 and a molecular weight of 380.34 g/mol. Its IUPAC name is 4-bromo-1-N-[(2-methylsulfanyl-1,3-benzothiazol-4-yl)methyl]benzene-1,2-diamine.
| Compound Name | 4-bromo-1-N-[(2-methylsulfanyl-1,3-benzothiazol-4-yl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 172852922 |
| Molecular Formula | C15H14BrN3S2 |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 378.98 |
| IUPAC Name | 4-bromo-1-N-[(2-methylsulfanyl-1,3-benzothiazol-4-yl)methyl]benzene-1,2-diamine |
| SMILES | CSc1nc2c(CNc3ccc(Br)cc3N)cccc2s1 |
| InChI | InChI=1S/C15H14BrN3S2/c1-20-15-19-14-9(3-2-4-13(14)21-15)8-18-12-6-5-10(16)7-11(12)17/h2-7,18H,8,17H2,1H3 |
| InChIKey | YHQIXBSOMWGVGN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|