C16H17N3OS2 — CID 172688559
4-methoxy-1-N-[(2-methylsulfanyl-1,3-benzothiazol-4-yl)methyl]benzene-1,2-diamine (PubChem CID 172688559) has the molecular formula C16H17N3OS2 and a molecular weight of 331.47 g/mol. Its IUPAC name is 4-methoxy-1-N-[(2-methylsulfanyl-1,3-benzothiazol-4-yl)methyl]benzene-1,2-diamine.
| Compound Name | 4-methoxy-1-N-[(2-methylsulfanyl-1,3-benzothiazol-4-yl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 172688559 |
| Molecular Formula | C16H17N3OS2 |
| Molecular Weight | 331.47 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 4-methoxy-1-N-[(2-methylsulfanyl-1,3-benzothiazol-4-yl)methyl]benzene-1,2-diamine |
| SMILES | COc1ccc(NCc2cccc3sc(SC)nc23)c(N)c1 |
| InChI | InChI=1S/C16H17N3OS2/c1-20-11-6-7-13(12(17)8-11)18-9-10-4-3-5-14-15(10)19-16(21-2)22-14/h3-8,18H,9,17H2,1-2H3 |
| InChIKey | BJBUVVDREJCWBI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|