C9H6N2S2 — CID 141046586
2-methylsulfanyl-1,3-benzothiazole-4-carbonitrile (PubChem CID 141046586) has the molecular formula C9H6N2S2 and a molecular weight of 206.30 g/mol. Its IUPAC name is 2-methylsulfanyl-1,3-benzothiazole-4-carbonitrile.
| Compound Name | 2-methylsulfanyl-1,3-benzothiazole-4-carbonitrile |
|---|---|
| PubChem CID | 141046586 |
| Molecular Formula | C9H6N2S2 |
| Molecular Weight | 206.30 g/mol |
| Exact Mass | 206.00 |
| IUPAC Name | 2-methylsulfanyl-1,3-benzothiazole-4-carbonitrile |
| SMILES | CSc1nc2c(C#N)cccc2s1 |
| InChI | InChI=1S/C9H6N2S2/c1-12-9-11-8-6(5-10)3-2-4-7(8)13-9/h2-4H,1H3 |
| InChIKey | BINFVPFGLLJFSS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |