About 2-[(4-sulfanyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole-4-thiol
2-[(4-sulfanyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole-4-thiol (PubChem CID 54503247) has the molecular formula C14H8N2S6
and a molecular weight of 396.63 g/mol. Its IUPAC name is 2-[(4-sulfanyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole-4-thiol.
Molecular Properties
| Compound Name | 2-[(4-sulfanyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole-4-thiol |
| PubChem CID | 54503247 |
| Molecular Formula | C14H8N2S6 |
| Molecular Weight | 396.63 g/mol |
| Exact Mass | 395.90 |
| IUPAC Name | 2-[(4-sulfanyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole-4-thiol |
| SMILES | Sc1cccc2sc(SSc3nc4c(S)cccc4s3)nc12 |
| InChI | InChI=1S/C14H8N2S6/c17-7-3-1-5-9-11(7)15-13(19-9)21-22-14-16-12-8(18)4-2-6-10(12)20-14/h1-6,17-18H |
| InChIKey | YDXNOHMZUXADGR-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 25.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.63 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-sulfanyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole-4-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-sulfanyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole-4-thiol?
The IUPAC name of 2-[(4-sulfanyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole-4-thiol (CID 54503247) is 2-[(4-sulfanyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole-4-thiol.
What is the SMILES notation for 2-[(4-sulfanyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole-4-thiol?
The canonical SMILES for 2-[(4-sulfanyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole-4-thiol is Sc1cccc2sc(SSc3nc4c(S)cccc4s3)nc12.
What is the InChIKey of 2-[(4-sulfanyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole-4-thiol?
The InChIKey is YDXNOHMZUXADGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N2S6/c17-7-3-1-5-9-11(7)15-13(19-9)21-22-14-16-12-8(18)4-2-6-10(12)20-14/h1-6,17-18H.
What are the key properties of 2-[(4-sulfanyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole-4-thiol?
2-[(4-sulfanyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole-4-thiol has a molecular weight of 396.63 g/mol, XLogP of 6.28, 3 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-sulfanyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole-4-thiol is sourced from PubChem (CID 54503247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).