About 2-(chloromethyl)-1,3-benzothiazole-4-thiol
2-(chloromethyl)-1,3-benzothiazole-4-thiol (PubChem CID 150787506) has the molecular formula C8H6ClNS2
and a molecular weight of 215.73 g/mol. Its IUPAC name is 2-(chloromethyl)-1,3-benzothiazole-4-thiol.
Molecular Properties
| Compound Name | 2-(chloromethyl)-1,3-benzothiazole-4-thiol |
| PubChem CID | 150787506 |
| Molecular Formula | C8H6ClNS2 |
| Molecular Weight | 215.73 g/mol |
| Exact Mass | 214.96 |
| IUPAC Name | 2-(chloromethyl)-1,3-benzothiazole-4-thiol |
| SMILES | Sc1cccc2sc(CCl)nc12 |
| InChI | InChI=1S/C8H6ClNS2/c9-4-7-10-8-5(11)2-1-3-6(8)12-7/h1-3,11H,4H2 |
| InChIKey | KDDXSUBTTMTZIE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.73 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-1,3-benzothiazole-4-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-1,3-benzothiazole-4-thiol?
The IUPAC name of 2-(chloromethyl)-1,3-benzothiazole-4-thiol (CID 150787506) is 2-(chloromethyl)-1,3-benzothiazole-4-thiol.
What is the SMILES notation for 2-(chloromethyl)-1,3-benzothiazole-4-thiol?
The canonical SMILES for 2-(chloromethyl)-1,3-benzothiazole-4-thiol is Sc1cccc2sc(CCl)nc12.
What is the InChIKey of 2-(chloromethyl)-1,3-benzothiazole-4-thiol?
The InChIKey is KDDXSUBTTMTZIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClNS2/c9-4-7-10-8-5(11)2-1-3-6(8)12-7/h1-3,11H,4H2.
What are the key properties of 2-(chloromethyl)-1,3-benzothiazole-4-thiol?
2-(chloromethyl)-1,3-benzothiazole-4-thiol has a molecular weight of 215.73 g/mol, XLogP of 3.32, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-1,3-benzothiazole-4-thiol is sourced from PubChem (CID 150787506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).