C9H6ClNO2S — CID 71743774
2-(4-chloro-1,3-benzothiazol-2-yl)acetic acid (PubChem CID 71743774) has the molecular formula C9H6ClNO2S and a molecular weight of 227.67 g/mol. Its IUPAC name is 2-(4-chloro-1,3-benzothiazol-2-yl)acetic acid.
| Compound Name | 2-(4-chloro-1,3-benzothiazol-2-yl)acetic acid |
|---|---|
| PubChem CID | 71743774 |
| Molecular Formula | C9H6ClNO2S |
| Molecular Weight | 227.67 g/mol |
| Exact Mass | 226.98 |
| IUPAC Name | 2-(4-chloro-1,3-benzothiazol-2-yl)acetic acid |
| SMILES | O=C(O)Cc1nc2c(Cl)cccc2s1 |
| InChI | InChI=1S/C9H6ClNO2S/c10-5-2-1-3-6-9(5)11-7(14-6)4-8(12)13/h1-3H,4H2,(H,12,13) |
| InChIKey | CTTBVJTVGYNSIB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.67 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |