C10H10N2S — CID 67908598
2-prop-2-enyl-1,3-benzothiazol-4-amine (PubChem CID 67908598) has the molecular formula C10H10N2S and a molecular weight of 190.27 g/mol. Its IUPAC name is 2-prop-2-enyl-1,3-benzothiazol-4-amine.
| Compound Name | 2-prop-2-enyl-1,3-benzothiazol-4-amine |
|---|---|
| PubChem CID | 67908598 |
| Molecular Formula | C10H10N2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 2-prop-2-enyl-1,3-benzothiazol-4-amine |
| SMILES | C=CCc1nc2c(N)cccc2s1 |
| InChI | InChI=1S/C10H10N2S/c1-2-4-9-12-10-7(11)5-3-6-8(10)13-9/h2-3,5-6H,1,4,11H2 |
| InChIKey | SXHOKCYVDINSIB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|