About 2-prop-2-enyl-1,3-benzothiazol-4-amine
2-prop-2-enyl-1,3-benzothiazol-4-amine (PubChem CID 67908598) has the molecular formula C10H10N2S
and a molecular weight of 190.27 g/mol. Its IUPAC name is 2-prop-2-enyl-1,3-benzothiazol-4-amine.
Molecular Properties
| Compound Name | 2-prop-2-enyl-1,3-benzothiazol-4-amine |
| PubChem CID | 67908598 |
| Molecular Formula | C10H10N2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 2-prop-2-enyl-1,3-benzothiazol-4-amine |
| SMILES | C=CCc1nc2c(N)cccc2s1 |
| InChI | InChI=1S/C10H10N2S/c1-2-4-9-12-10-7(11)5-3-6-8(10)13-9/h2-3,5-6H,1,4,11H2 |
| InChIKey | SXHOKCYVDINSIB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enyl-1,3-benzothiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enyl-1,3-benzothiazol-4-amine?
The IUPAC name of 2-prop-2-enyl-1,3-benzothiazol-4-amine (CID 67908598) is 2-prop-2-enyl-1,3-benzothiazol-4-amine.
What is the SMILES notation for 2-prop-2-enyl-1,3-benzothiazol-4-amine?
The canonical SMILES for 2-prop-2-enyl-1,3-benzothiazol-4-amine is C=CCc1nc2c(N)cccc2s1.
What is the InChIKey of 2-prop-2-enyl-1,3-benzothiazol-4-amine?
The InChIKey is SXHOKCYVDINSIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2S/c1-2-4-9-12-10-7(11)5-3-6-8(10)13-9/h2-3,5-6H,1,4,11H2.
What are the key properties of 2-prop-2-enyl-1,3-benzothiazol-4-amine?
2-prop-2-enyl-1,3-benzothiazol-4-amine has a molecular weight of 190.27 g/mol, XLogP of 2.61, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enyl-1,3-benzothiazol-4-amine is sourced from PubChem (CID 67908598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).