C16H16N2S — CID 107273677
2-[2-(4-methyl-1,3-benzothiazol-2-yl)ethyl]aniline (PubChem CID 107273677) has the molecular formula C16H16N2S and a molecular weight of 268.38 g/mol. Its IUPAC name is 2-[2-(4-methyl-1,3-benzothiazol-2-yl)ethyl]aniline.
| Compound Name | 2-[2-(4-methyl-1,3-benzothiazol-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 107273677 |
| Molecular Formula | C16H16N2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 2-[2-(4-methyl-1,3-benzothiazol-2-yl)ethyl]aniline |
| SMILES | Cc1cccc2sc(CCc3ccccc3N)nc12 |
| InChI | InChI=1S/C16H16N2S/c1-11-5-4-8-14-16(11)18-15(19-14)10-9-12-6-2-3-7-13(12)17/h2-8H,9-10,17H2,1H3 |
| InChIKey | UTJMTNZUIYSJRA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|