C12H16N4S — CID 82480391
5-[2-(2-aminophenyl)ethyl]-N,N-dimethyl-1,3,4-thiadiazol-2-amine (PubChem CID 82480391) has the molecular formula C12H16N4S and a molecular weight of 248.36 g/mol. Its IUPAC name is 5-[2-(2-aminophenyl)ethyl]-N,N-dimethyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[2-(2-aminophenyl)ethyl]-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 82480391 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 5-[2-(2-aminophenyl)ethyl]-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
| SMILES | CN(C)c1nnc(CCc2ccccc2N)s1 |
| InChI | InChI=1S/C12H16N4S/c1-16(2)12-15-14-11(17-12)8-7-9-5-3-4-6-10(9)13/h3-6H,7-8,13H2,1-2H3 |
| InChIKey | UGQXLLFSSFICOK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|