C16H10N2S4 — CID 57199614
2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]-1,3-benzothiazole-4-thiol (PubChem CID 57199614) has the molecular formula C16H10N2S4 and a molecular weight of 358.54 g/mol. Its IUPAC name is 2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]-1,3-benzothiazole-4-thiol.
| Compound Name | 2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]-1,3-benzothiazole-4-thiol |
|---|---|
| PubChem CID | 57199614 |
| Molecular Formula | C16H10N2S4 |
| Molecular Weight | 358.54 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | 2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]-1,3-benzothiazole-4-thiol |
| SMILES | Sc1cccc2sc(Sc3nc(-c4ccccc4)cs3)nc12 |
| InChI | InChI=1S/C16H10N2S4/c19-12-7-4-8-13-14(12)18-16(21-13)22-15-17-11(9-20-15)10-5-2-1-3-6-10/h1-9,19H |
| InChIKey | WNBLPPUSLWLDOJ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 25.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.54 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|