C11H8N4S2 — CID 18708680
4-phenyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3-thiazole (PubChem CID 18708680) has the molecular formula C11H8N4S2 and a molecular weight of 260.35 g/mol. Its IUPAC name is 4-phenyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3-thiazole.
| Compound Name | 4-phenyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3-thiazole |
|---|---|
| PubChem CID | 18708680 |
| Molecular Formula | C11H8N4S2 |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 4-phenyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3-thiazole |
| SMILES | c1ccc(-c2csc(Sc3ncn[nH]3)n2)cc1 |
| InChI | InChI=1S/C11H8N4S2/c1-2-4-8(5-3-1)9-6-16-11(14-9)17-10-12-7-13-15-10/h1-7H,(H,12,13,15) |
| InChIKey | RTDKVRNVSGNCEI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |