C20H16N2O2S6 — CID 88662627
1-S,4-S-bis(4-methylsulfanyl-1,3-benzothiazol-2-yl) butanebis(thioate) (PubChem CID 88662627) has the molecular formula C20H16N2O2S6 and a molecular weight of 508.76 g/mol. Its IUPAC name is 1-S,4-S-bis(4-methylsulfanyl-1,3-benzothiazol-2-yl) butanebis(thioate).
| Compound Name | 1-S,4-S-bis(4-methylsulfanyl-1,3-benzothiazol-2-yl) butanebis(thioate) |
|---|---|
| PubChem CID | 88662627 |
| Molecular Formula | C20H16N2O2S6 |
| Molecular Weight | 508.76 g/mol |
| Exact Mass | 507.95 |
| IUPAC Name | 1-S,4-S-bis(4-methylsulfanyl-1,3-benzothiazol-2-yl) butanebis(thioate) |
| SMILES | CSc1cccc2sc(SC(=O)CCC(=O)Sc3nc4c(SC)cccc4s3)nc12 |
| InChI | InChI=1S/C20H16N2O2S6/c1-25-11-5-3-7-13-17(11)21-19(27-13)29-15(23)9-10-16(24)30-20-22-18-12(26-2)6-4-8-14(18)28-20/h3-8H,9-10H2,1-2H3 |
| InChIKey | IHHFRRLFHBUZDO-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.76 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|