C19H20N2OS3 — CID 8700373
4-(4-methylphenyl)sulfanyl-N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)butanamide (PubChem CID 8700373) has the molecular formula C19H20N2OS3 and a molecular weight of 388.58 g/mol. Its IUPAC name is 4-(4-methylphenyl)sulfanyl-N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)butanamide.
| Compound Name | 4-(4-methylphenyl)sulfanyl-N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 8700373 |
| Molecular Formula | C19H20N2OS3 |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 4-(4-methylphenyl)sulfanyl-N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)butanamide |
| SMILES | CSc1cccc2sc(NC(=O)CCCSc3ccc(C)cc3)nc12 |
| InChI | InChI=1S/C19H20N2OS3/c1-13-8-10-14(11-9-13)24-12-4-7-17(22)20-19-21-18-15(23-2)5-3-6-16(18)25-19/h3,5-6,8-11H,4,7,12H2,1-2H3,(H,20,21,22) |
| InChIKey | YDCXEGLDNSEPOI-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|