C21H24N2O2S2 — CID 16938521
4-(4-methoxyphenyl)sulfanyl-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)butanamide (PubChem CID 16938521) has the molecular formula C21H24N2O2S2 and a molecular weight of 400.57 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)sulfanyl-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)butanamide.
| Compound Name | 4-(4-methoxyphenyl)sulfanyl-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 16938521 |
| Molecular Formula | C21H24N2O2S2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 4-(4-methoxyphenyl)sulfanyl-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)butanamide |
| SMILES | COc1ccc(SCCCC(=O)Nc2nc3c(C(C)C)cccc3s2)cc1 |
| InChI | InChI=1S/C21H24N2O2S2/c1-14(2)17-6-4-7-18-20(17)23-21(27-18)22-19(24)8-5-13-26-16-11-9-15(25-3)10-12-16/h4,6-7,9-12,14H,5,8,13H2,1-3H3,(H,22,23,24) |
| InChIKey | HBXCMLFSEUAPBT-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|