C20H22N2O3S2 — CID 41086596
N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-4-(4-methoxyphenyl)sulfanylbutanamide (PubChem CID 41086596) has the molecular formula C20H22N2O3S2 and a molecular weight of 402.54 g/mol. Its IUPAC name is N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-4-(4-methoxyphenyl)sulfanylbutanamide.
| Compound Name | N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-4-(4-methoxyphenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 41086596 |
| Molecular Formula | C20H22N2O3S2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-4-(4-methoxyphenyl)sulfanylbutanamide |
| SMILES | COc1ccc(SCCCC(=O)Nc2nc3c(OC)ccc(C)c3s2)cc1 |
| InChI | InChI=1S/C20H22N2O3S2/c1-13-6-11-16(25-3)18-19(13)27-20(22-18)21-17(23)5-4-12-26-15-9-7-14(24-2)8-10-15/h6-11H,4-5,12H2,1-3H3,(H,21,22,23) |
| InChIKey | CGLKDXAONXVRQA-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|