C22H24N2O4S2 — CID 18585602
N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-4-(4-methoxyphenyl)sulfanylbutanamide (PubChem CID 18585602) has the molecular formula C22H24N2O4S2 and a molecular weight of 444.58 g/mol. Its IUPAC name is N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-4-(4-methoxyphenyl)sulfanylbutanamide.
| Compound Name | N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-4-(4-methoxyphenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 18585602 |
| Molecular Formula | C22H24N2O4S2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-4-(4-methoxyphenyl)sulfanylbutanamide |
| SMILES | COc1ccc(SCCCC(=O)Nc2nc(-c3ccc(OC)c(OC)c3)cs2)cc1 |
| InChI | InChI=1S/C22H24N2O4S2/c1-26-16-7-9-17(10-8-16)29-12-4-5-21(25)24-22-23-18(14-30-22)15-6-11-19(27-2)20(13-15)28-3/h6-11,13-14H,4-5,12H2,1-3H3,(H,23,24,25) |
| InChIKey | KFIWHDFJUVIXFP-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|