C15H19N3O3S — CID 92944336
4-amino-N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]butanamide (PubChem CID 92944336) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 4-amino-N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]butanamide.
| Compound Name | 4-amino-N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 92944336 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 4-amino-N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]butanamide |
| SMILES | COc1ccc(-c2csc(NC(=O)CCCN)n2)cc1OC |
| InChI | InChI=1S/C15H19N3O3S/c1-20-12-6-5-10(8-13(12)21-2)11-9-22-15(17-11)18-14(19)4-3-7-16/h5-6,8-9H,3-4,7,16H2,1-2H3,(H,17,18,19) |
| InChIKey | UFSAEMRQWIHUTH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |