C18H19N3OS2 — CID 121081224
1-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-3-(3-phenylpropyl)urea (PubChem CID 121081224) has the molecular formula C18H19N3OS2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 1-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-3-(3-phenylpropyl)urea.
| Compound Name | 1-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-3-(3-phenylpropyl)urea |
|---|---|
| PubChem CID | 121081224 |
| Molecular Formula | C18H19N3OS2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 1-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-3-(3-phenylpropyl)urea |
| SMILES | CSc1cccc2sc(NC(=O)NCCCc3ccccc3)nc12 |
| InChI | InChI=1S/C18H19N3OS2/c1-23-14-10-5-11-15-16(14)20-18(24-15)21-17(22)19-12-6-9-13-7-3-2-4-8-13/h2-5,7-8,10-11H,6,9,12H2,1H3,(H2,19,20,21,22) |
| InChIKey | RCPKQSOQAYLQSN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|