About 4-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-N-(3-phenylpropyl)piperazine-1-carboxamide
4-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-N-(3-phenylpropyl)piperazine-1-carboxamide (PubChem CID 121081301) has the molecular formula C22H26N4OS2
and a molecular weight of 426.61 g/mol. Its IUPAC name is 4-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-N-(3-phenylpropyl)piperazine-1-carboxamide.
Molecular Properties
| Compound Name | 4-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-N-(3-phenylpropyl)piperazine-1-carboxamide |
| PubChem CID | 121081301 |
| Molecular Formula | C22H26N4OS2 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 4-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-N-(3-phenylpropyl)piperazine-1-carboxamide |
| SMILES | CSc1cccc2sc(N3CCN(C(=O)NCCCc4ccccc4)CC3)nc12 |
| InChI | InChI=1S/C22H26N4OS2/c1-28-18-10-5-11-19-20(18)24-22(29-19)26-15-13-25(14-16-26)21(27)23-12-6-9-17-7-3-2-4-8-17/h2-5,7-8,10-11H,6,9,12-16H2,1H3,(H,23,27) |
| InChIKey | NEYAYOHUHJWCEG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-N-(3-phenylpropyl)piperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-N-(3-phenylpropyl)piperazine-1-carboxamide?
The IUPAC name of 4-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-N-(3-phenylpropyl)piperazine-1-carboxamide (CID 121081301) is 4-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-N-(3-phenylpropyl)piperazine-1-carboxamide.
What is the SMILES notation for 4-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-N-(3-phenylpropyl)piperazine-1-carboxamide?
The canonical SMILES for 4-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-N-(3-phenylpropyl)piperazine-1-carboxamide is CSc1cccc2sc(N3CCN(C(=O)NCCCc4ccccc4)CC3)nc12.
What is the InChIKey of 4-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-N-(3-phenylpropyl)piperazine-1-carboxamide?
The InChIKey is NEYAYOHUHJWCEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N4OS2/c1-28-18-10-5-11-19-20(18)24-22(29-19)26-15-13-25(14-16-26)21(27)23-12-6-9-17-7-3-2-4-8-17/h2-5,7-8,10-11H,6,9,12-16H2,1H3,(H,23,27).
What are the key properties of 4-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-N-(3-phenylpropyl)piperazine-1-carboxamide?
4-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-N-(3-phenylpropyl)piperazine-1-carboxamide has a molecular weight of 426.61 g/mol, XLogP of 4.48, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-N-(3-phenylpropyl)piperazine-1-carboxamide is sourced from PubChem (CID 121081301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).