C19H21N3OS — CID 121081369
1-(2-phenylethyl)-3-(4-propan-2-yl-1,3-benzothiazol-2-yl)urea (PubChem CID 121081369) has the molecular formula C19H21N3OS and a molecular weight of 339.46 g/mol. Its IUPAC name is 1-(2-phenylethyl)-3-(4-propan-2-yl-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-(2-phenylethyl)-3-(4-propan-2-yl-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 121081369 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 1-(2-phenylethyl)-3-(4-propan-2-yl-1,3-benzothiazol-2-yl)urea |
| SMILES | CC(C)c1cccc2sc(NC(=O)NCCc3ccccc3)nc12 |
| InChI | InChI=1S/C19H21N3OS/c1-13(2)15-9-6-10-16-17(15)21-19(24-16)22-18(23)20-12-11-14-7-4-3-5-8-14/h3-10,13H,11-12H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | XOBXODNYNDRXGH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |