About (2S)-2-[(4-bromo-1,3-benzothiazol-2-yl)sulfanyl]propanamide
(2S)-2-[(4-bromo-1,3-benzothiazol-2-yl)sulfanyl]propanamide (PubChem CID 129358166) has the molecular formula C10H9BrN2OS2
and a molecular weight of 317.23 g/mol. Its IUPAC name is (2S)-2-[(4-bromo-1,3-benzothiazol-2-yl)sulfanyl]propanamide.
Molecular Properties
| Compound Name | (2S)-2-[(4-bromo-1,3-benzothiazol-2-yl)sulfanyl]propanamide |
| PubChem CID | 129358166 |
| Molecular Formula | C10H9BrN2OS2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 315.93 |
| IUPAC Name | (2S)-2-[(4-bromo-1,3-benzothiazol-2-yl)sulfanyl]propanamide |
| SMILES | C[C@H](Sc1nc2c(Br)cccc2s1)C(N)=O |
| InChI | InChI=1S/C10H9BrN2OS2/c1-5(9(12)14)15-10-13-8-6(11)3-2-4-7(8)16-10/h2-5H,1H3,(H2,12,14)/t5-/m0/s1 |
| InChIKey | CKFZUAGCBWEZHL-YFKPBYRVSA-N |
| XLogP | 3.02 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-[(4-bromo-1,3-benzothiazol-2-yl)sulfanyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(4-bromo-1,3-benzothiazol-2-yl)sulfanyl]propanamide?
The IUPAC name of (2S)-2-[(4-bromo-1,3-benzothiazol-2-yl)sulfanyl]propanamide (CID 129358166) is (2S)-2-[(4-bromo-1,3-benzothiazol-2-yl)sulfanyl]propanamide.
What is the SMILES notation for (2S)-2-[(4-bromo-1,3-benzothiazol-2-yl)sulfanyl]propanamide?
The canonical SMILES for (2S)-2-[(4-bromo-1,3-benzothiazol-2-yl)sulfanyl]propanamide is C[C@H](Sc1nc2c(Br)cccc2s1)C(N)=O.
What is the InChIKey of (2S)-2-[(4-bromo-1,3-benzothiazol-2-yl)sulfanyl]propanamide?
The InChIKey is CKFZUAGCBWEZHL-YFKPBYRVSA-N. The full InChI is InChI=1S/C10H9BrN2OS2/c1-5(9(12)14)15-10-13-8-6(11)3-2-4-7(8)16-10/h2-5H,1H3,(H2,12,14)/t5-/m0/s1.
What are the key properties of (2S)-2-[(4-bromo-1,3-benzothiazol-2-yl)sulfanyl]propanamide?
(2S)-2-[(4-bromo-1,3-benzothiazol-2-yl)sulfanyl]propanamide has a molecular weight of 317.23 g/mol, XLogP of 3.02, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(4-bromo-1,3-benzothiazol-2-yl)sulfanyl]propanamide is sourced from PubChem (CID 129358166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).