C7H10N2OS2 — CID 7499825
(2S)-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propanamide (PubChem CID 7499825) has the molecular formula C7H10N2OS2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (2S)-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propanamide.
| Compound Name | (2S)-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 7499825 |
| Molecular Formula | C7H10N2OS2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | (2S)-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propanamide |
| SMILES | Cc1csc(S[C@@H](C)C(N)=O)n1 |
| InChI | InChI=1S/C7H10N2OS2/c1-4-3-11-7(9-4)12-5(2)6(8)10/h3,5H,1-2H3,(H2,8,10)/t5-/m0/s1 |
| InChIKey | NXQBSWRBBKYYOM-YFKPBYRVSA-N |
| XLogP | 1.42 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |