C13H15N3OS2 — CID 43187503
N-(3-aminophenyl)-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propanamide (PubChem CID 43187503) has the molecular formula C13H15N3OS2 and a molecular weight of 293.42 g/mol. Its IUPAC name is N-(3-aminophenyl)-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propanamide.
| Compound Name | N-(3-aminophenyl)-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 43187503 |
| Molecular Formula | C13H15N3OS2 |
| Molecular Weight | 293.42 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | N-(3-aminophenyl)-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propanamide |
| SMILES | Cc1csc(SC(C)C(=O)Nc2cccc(N)c2)n1 |
| InChI | InChI=1S/C13H15N3OS2/c1-8-7-18-13(15-8)19-9(2)12(17)16-11-5-3-4-10(14)6-11/h3-7,9H,14H2,1-2H3,(H,16,17) |
| InChIKey | AMEXYSYOYNFLKJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|