C13H13Cl2N3OS2 — CID 43105972
N-(2-amino-4,6-dichlorophenyl)-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propanamide (PubChem CID 43105972) has the molecular formula C13H13Cl2N3OS2 and a molecular weight of 362.31 g/mol. Its IUPAC name is N-(2-amino-4,6-dichlorophenyl)-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propanamide.
| Compound Name | N-(2-amino-4,6-dichlorophenyl)-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 43105972 |
| Molecular Formula | C13H13Cl2N3OS2 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | N-(2-amino-4,6-dichlorophenyl)-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propanamide |
| SMILES | Cc1csc(SC(C)C(=O)Nc2c(N)cc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C13H13Cl2N3OS2/c1-6-5-20-13(17-6)21-7(2)12(19)18-11-9(15)3-8(14)4-10(11)16/h3-5,7H,16H2,1-2H3,(H,18,19) |
| InChIKey | UMNJGBIPLQZFJN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|