C13H14ClN3OS2 — CID 43104704
N-(3-amino-4-chlorophenyl)-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propanamide (PubChem CID 43104704) has the molecular formula C13H14ClN3OS2 and a molecular weight of 327.86 g/mol. Its IUPAC name is N-(3-amino-4-chlorophenyl)-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propanamide.
| Compound Name | N-(3-amino-4-chlorophenyl)-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 43104704 |
| Molecular Formula | C13H14ClN3OS2 |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | N-(3-amino-4-chlorophenyl)-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propanamide |
| SMILES | Cc1csc(SC(C)C(=O)Nc2ccc(Cl)c(N)c2)n1 |
| InChI | InChI=1S/C13H14ClN3OS2/c1-7-6-19-13(16-7)20-8(2)12(18)17-9-3-4-10(14)11(15)5-9/h3-6,8H,15H2,1-2H3,(H,17,18) |
| InChIKey | FZMKCAYGAAUYSQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|