C14H15ClN4OS — CID 62268721
N-(3-amino-4-chlorophenyl)-2-(4-methylpyrimidin-2-yl)sulfanylpropanamide (PubChem CID 62268721) has the molecular formula C14H15ClN4OS and a molecular weight of 322.82 g/mol. Its IUPAC name is N-(3-amino-4-chlorophenyl)-2-(4-methylpyrimidin-2-yl)sulfanylpropanamide.
| Compound Name | N-(3-amino-4-chlorophenyl)-2-(4-methylpyrimidin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 62268721 |
| Molecular Formula | C14H15ClN4OS |
| Molecular Weight | 322.82 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | N-(3-amino-4-chlorophenyl)-2-(4-methylpyrimidin-2-yl)sulfanylpropanamide |
| SMILES | Cc1ccnc(SC(C)C(=O)Nc2ccc(Cl)c(N)c2)n1 |
| InChI | InChI=1S/C14H15ClN4OS/c1-8-5-6-17-14(18-8)21-9(2)13(20)19-10-3-4-11(15)12(16)7-10/h3-7,9H,16H2,1-2H3,(H,19,20) |
| InChIKey | YPZDBTYXUYOXIB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.82 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|