C14H17ClN4OS — CID 62409917
N-(3-amino-4-chlorophenyl)-2-(2,5-dimethylpyrazol-3-yl)sulfanylpropanamide (PubChem CID 62409917) has the molecular formula C14H17ClN4OS and a molecular weight of 324.84 g/mol. Its IUPAC name is N-(3-amino-4-chlorophenyl)-2-(2,5-dimethylpyrazol-3-yl)sulfanylpropanamide.
| Compound Name | N-(3-amino-4-chlorophenyl)-2-(2,5-dimethylpyrazol-3-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 62409917 |
| Molecular Formula | C14H17ClN4OS |
| Molecular Weight | 324.84 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | N-(3-amino-4-chlorophenyl)-2-(2,5-dimethylpyrazol-3-yl)sulfanylpropanamide |
| SMILES | Cc1cc(SC(C)C(=O)Nc2ccc(Cl)c(N)c2)n(C)n1 |
| InChI | InChI=1S/C14H17ClN4OS/c1-8-6-13(19(3)18-8)21-9(2)14(20)17-10-4-5-11(15)12(16)7-10/h4-7,9H,16H2,1-3H3,(H,17,20) |
| InChIKey | RGLDIYJRDMJYEM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.84 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|