C14H16BrClN4O — CID 62128703
N-(3-amino-4-chlorophenyl)-2-(4-bromo-3,5-dimethylpyrazol-1-yl)propanamide (PubChem CID 62128703) has the molecular formula C14H16BrClN4O and a molecular weight of 371.67 g/mol. Its IUPAC name is N-(3-amino-4-chlorophenyl)-2-(4-bromo-3,5-dimethylpyrazol-1-yl)propanamide.
| Compound Name | N-(3-amino-4-chlorophenyl)-2-(4-bromo-3,5-dimethylpyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 62128703 |
| Molecular Formula | C14H16BrClN4O |
| Molecular Weight | 371.67 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | N-(3-amino-4-chlorophenyl)-2-(4-bromo-3,5-dimethylpyrazol-1-yl)propanamide |
| SMILES | Cc1nn(C(C)C(=O)Nc2ccc(Cl)c(N)c2)c(C)c1Br |
| InChI | InChI=1S/C14H16BrClN4O/c1-7-13(15)8(2)20(19-7)9(3)14(21)18-10-4-5-11(16)12(17)6-10/h4-6,9H,17H2,1-3H3,(H,18,21) |
| InChIKey | UIMBNYQPSGNYKP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.67 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|