C12H13Cl2N5OS — CID 61345279
N-(2-amino-4,6-dichlorophenyl)-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 61345279) has the molecular formula C12H13Cl2N5OS and a molecular weight of 346.24 g/mol. Its IUPAC name is N-(2-amino-4,6-dichlorophenyl)-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | N-(2-amino-4,6-dichlorophenyl)-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 61345279 |
| Molecular Formula | C12H13Cl2N5OS |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | N-(2-amino-4,6-dichlorophenyl)-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | Cc1nc(SC(C)C(=O)Nc2c(N)cc(Cl)cc2Cl)n[nH]1 |
| InChI | InChI=1S/C12H13Cl2N5OS/c1-5(21-12-16-6(2)18-19-12)11(20)17-10-8(14)3-7(13)4-9(10)15/h3-5H,15H2,1-2H3,(H,17,20)(H,16,18,19) |
| InChIKey | PRGXQTCFQBWOTE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|