C11H10Cl3N5OS — CID 2340259
(2R)-2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide (PubChem CID 2340259) has the molecular formula C11H10Cl3N5OS and a molecular weight of 366.66 g/mol. Its IUPAC name is (2R)-2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide.
| Compound Name | (2R)-2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 2340259 |
| Molecular Formula | C11H10Cl3N5OS |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 364.97 |
| IUPAC Name | (2R)-2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide |
| SMILES | C[C@@H](Sc1n[nH]c(N)n1)C(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H10Cl3N5OS/c1-4(21-11-17-10(15)18-19-11)9(20)16-8-3-6(13)5(12)2-7(8)14/h2-4H,1H3,(H,16,20)(H3,15,17,18,19)/t4-/m1/s1 |
| InChIKey | RTQXABLKXQDXIE-SCSAIBSYSA-N |
| XLogP | 3.47 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|