C6H10N4OS — CID 130685553
3-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]butan-2-one (PubChem CID 130685553) has the molecular formula C6H10N4OS and a molecular weight of 186.24 g/mol. Its IUPAC name is 3-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]butan-2-one.
| Compound Name | 3-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]butan-2-one |
|---|---|
| PubChem CID | 130685553 |
| Molecular Formula | C6H10N4OS |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 3-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]butan-2-one |
| SMILES | CC(=O)C(C)Sc1n[nH]c(N)n1 |
| InChI | InChI=1S/C6H10N4OS/c1-3(11)4(2)12-6-8-5(7)9-10-6/h4H,1-2H3,(H3,7,8,9,10) |
| InChIKey | CQPXLNLKNCTGSH-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |