C7H14N6OS — CID 79404938
3-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-2-methylbutanehydrazide (PubChem CID 79404938) has the molecular formula C7H14N6OS and a molecular weight of 230.30 g/mol. Its IUPAC name is 3-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-2-methylbutanehydrazide.
| Compound Name | 3-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-2-methylbutanehydrazide |
|---|---|
| PubChem CID | 79404938 |
| Molecular Formula | C7H14N6OS |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 3-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-2-methylbutanehydrazide |
| SMILES | CC(Sc1n[nH]c(N)n1)C(C)C(=O)NN |
| InChI | InChI=1S/C7H14N6OS/c1-3(5(14)11-9)4(2)15-7-10-6(8)12-13-7/h3-4H,9H2,1-2H3,(H,11,14)(H3,8,10,12,13) |
| InChIKey | IHRQWWMVTAJEIZ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|