C11H18N4OS — CID 79405255
3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-methylbutanehydrazide (PubChem CID 79405255) has the molecular formula C11H18N4OS and a molecular weight of 254.36 g/mol. Its IUPAC name is 3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-methylbutanehydrazide.
| Compound Name | 3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-methylbutanehydrazide |
|---|---|
| PubChem CID | 79405255 |
| Molecular Formula | C11H18N4OS |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-methylbutanehydrazide |
| SMILES | Cc1cc(C)nc(SC(C)C(C)C(=O)NN)n1 |
| InChI | InChI=1S/C11H18N4OS/c1-6-5-7(2)14-11(13-6)17-9(4)8(3)10(16)15-12/h5,8-9H,12H2,1-4H3,(H,15,16) |
| InChIKey | NXTJOTISFVGIEY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|